Categories:
Audio (13)
Biotech (29)
Bytecode (36)
Database (77)
Framework (7)
Game (7)
General (507)
Graphics (53)
I/O (35)
IDE (2)
JAR Tools (102)
JavaBeans (21)
JDBC (121)
JDK (426)
JSP (20)
Logging (108)
Mail (58)
Messaging (8)
Network (84)
PDF (97)
Report (7)
Scripting (84)
Security (32)
Server (121)
Servlet (26)
SOAP (24)
Testing (54)
Web (15)
XML (322)
Collections:
Other Resources:
Jackson Data Binding Source Code
Jackson is "the Java JSON library" or "the best JSON parser for Java". Or simply as "JSON for Java".
Jackson Databind Source Code files are provided in the source packge (jackson-databind-2.14.0-sources.jar). You can download it at Jackson Maven Website.
You can also browse Jackson Databind Source Code below:
✍: FYIcenter.com
⏎ com/fasterxml/jackson/databind/JsonNode.java
package com.fasterxml.jackson.databind;
import java.io.IOException;
import java.math.BigDecimal;
import java.math.BigInteger;
import java.util.*;
import com.fasterxml.jackson.core.*;
import com.fasterxml.jackson.databind.node.ArrayNode;
import com.fasterxml.jackson.databind.node.JsonNodeType;
import com.fasterxml.jackson.databind.node.MissingNode;
import com.fasterxml.jackson.databind.node.ObjectNode;
import com.fasterxml.jackson.databind.util.ClassUtil;
/**
* Base class for all JSON nodes, which form the basis of JSON
* Tree Model that Jackson implements.
* One way to think of these nodes is to consider them
* similar to DOM nodes in XML DOM trees.
*<p>
* As a general design rule, most accessors ("getters") are included
* in this base class, to allow for traversing structure without
* type casts. Most mutators, however, need to be accessed through
* specific sub-classes (such as <code>ObjectNode</code>
* and <code>ArrayNode</code>).
* This seems sensible because proper type
* information is generally available when building or modifying
* trees, but less often when reading a tree (newly built from
* parsed JSON content).
*<p>
* Actual concrete sub-classes can be found from package
* {@link com.fasterxml.jackson.databind.node}.
*<p>
* Note that it is possible to "read" from nodes, using
* method {@link TreeNode#traverse(ObjectCodec)}, which will result in
* a {@link JsonParser} being constructed. This can be used for (relatively)
* efficient conversations between different representations; and it is what
* core databind uses for methods like {@link ObjectMapper#treeToValue(TreeNode, Class)}
* and {@link ObjectMapper#treeAsTokens(TreeNode)}
*/
public abstract class JsonNode
extends JsonSerializable.Base // i.e. implements JsonSerializable
implements TreeNode, Iterable<JsonNode>
{
/**
* Configuration setting used with {@link JsonNode#withObject(JsonPointer)}
* method overrides, to indicate which overwrites are acceptable if the
* path pointer indicates has incompatible nodes (for example, instead
* of Object node a Null node is encountered).
* Overwrite means that the existing value is replaced with compatible type,
* potentially losing existing values or even sub-trees.
*<p>
* Default value if {@code NULLS} which only allows Null-value nodes
* to be replaced but no other types.
*
* @since 2.14
*/
public enum OverwriteMode {
/**
* Mode in which no values may be overwritten, not even {@code NullNode}s;
* only compatible paths may be traversed.
*/
NONE,
/**
* Mode in which explicit {@code NullNode}s may be replaced but no other
* node types.
*/
NULLS,
/**
* Mode in which all scalar value nodes may be replaced, but not
* Array or Object nodes.
*/
SCALARS,
/**
* Mode in which all incompatible node types may be replaced, including
* Array and Object nodes where necessary.
*/
ALL;
}
/*
/**********************************************************
/* Construction, related
/**********************************************************
*/
protected JsonNode() { }
/**
* Method that can be called to get a node that is guaranteed
* not to allow changing of this node through mutators on
* this node or any of its children.
* This means it can either make a copy of this node (and all
* mutable children and grand children nodes), or node itself
* if it is immutable.
*<p>
* Note: return type is guaranteed to have same type as the
* node method is called on; which is why method is declared
* with local generic type.
*
* @since 2.0
*
* @return Node that is either a copy of this node (and all non-leaf
* children); or, for immutable leaf nodes, node itself.
*/
public abstract <T extends JsonNode> T deepCopy();
/*
/**********************************************************
/* TreeNode implementation
/**********************************************************
*/
// public abstract JsonToken asToken();
// public abstract JsonToken traverse();
// public abstract JsonToken traverse(ObjectCodec codec);
// public abstract JsonParser.NumberType numberType();
@Override
public int size() { return 0; }
/**
* Convenience method that is functionally same as:
*<pre>
* size() == 0
*</pre>
* for all node types.
*
* @since 2.10
*/
public boolean isEmpty() { return size() == 0; }
@Override
public final boolean isValueNode()
{
switch (getNodeType()) {
case ARRAY: case OBJECT: case MISSING:
return false;
default:
return true;
}
}
@Override
public final boolean isContainerNode() {
final JsonNodeType type = getNodeType();
return type == JsonNodeType.OBJECT || type == JsonNodeType.ARRAY;
}
@Override
public boolean isMissingNode() {
return false;
}
@Override
public boolean isArray() {
return false;
}
@Override
public boolean isObject() {
return false;
}
/**
* Method for accessing value of the specified element of
* an array node. For other nodes, null is always returned.
*<p>
* For array nodes, index specifies
* exact location within array and allows for efficient iteration
* over child elements (underlying storage is guaranteed to
* be efficiently indexable, i.e. has random-access to elements).
* If index is less than 0, or equal-or-greater than
* <code>node.size()</code>, null is returned; no exception is
* thrown for any index.
*<p>
* NOTE: if the element value has been explicitly set as <code>null</code>
* (which is different from removal!),
* a {@link com.fasterxml.jackson.databind.node.NullNode} will be returned,
* not null.
*
* @return Node that represent value of the specified element,
* if this node is an array and has specified element.
* Null otherwise.
*/
@Override
public abstract JsonNode get(int index);
/**
* Method for accessing value of the specified field of
* an object node. If this node is not an object (or it
* does not have a value for specified field name), or
* if there is no field with such name, null is returned.
*<p>
* NOTE: if the property value has been explicitly set as <code>null</code>
* (which is different from removal!),
* a {@link com.fasterxml.jackson.databind.node.NullNode} will be returned,
* not null.
*
* @return Node that represent value of the specified field,
* if this node is an object and has value for the specified
* field. Null otherwise.
*/
@Override
public JsonNode get(String fieldName) { return null; }
/**
* This method is similar to {@link #get(String)}, except
* that instead of returning null if no such value exists (due
* to this node not being an object, or object not having value
* for the specified field),
* a "missing node" (node that returns true for
* {@link #isMissingNode}) will be returned. This allows for
* convenient and safe chained access via path calls.
*/
@Override
public abstract JsonNode path(String fieldName);
/**
* This method is similar to {@link #get(int)}, except
* that instead of returning null if no such element exists (due
* to index being out of range, or this node not being an array),
* a "missing node" (node that returns true for
* {@link #isMissingNode}) will be returned. This allows for
* convenient and safe chained access via path calls.
*/
@Override
public abstract JsonNode path(int index);
@Override
public Iterator<String> fieldNames() {
return ClassUtil.emptyIterator();
}
/**
* Method for locating node specified by given JSON pointer instances.
* Method will never return null; if no matching node exists,
* will return a node for which {@link #isMissingNode()} returns true.
*
* @return Node that matches given JSON Pointer: if no match exists,
* will return a node for which {@link #isMissingNode()} returns true.
*
* @since 2.3
*/
@Override
public final JsonNode at(JsonPointer ptr)
{
// Basically: value nodes only match if we have "empty" path left
if (ptr.matches()) {
return this;
}
JsonNode n = _at(ptr);
if (n == null) {
return MissingNode.getInstance();
}
return n.at(ptr.tail());
}
/**
* Convenience method that is functionally equivalent to:
*<pre>
* return at(JsonPointer.valueOf(jsonPointerExpression));
*</pre>
*<p>
* Note that if the same expression is used often, it is preferable to construct
* {@link JsonPointer} instance once and reuse it: this method will not perform
* any caching of compiled expressions.
*
* @param jsonPtrExpr Expression to compile as a {@link JsonPointer}
* instance
*
* @return Node that matches given JSON Pointer: if no match exists,
* will return a node for which {@link TreeNode#isMissingNode()} returns true.
*
* @since 2.3
*/
@Override
public final JsonNode at(String jsonPtrExpr) {
return at(JsonPointer.compile(jsonPtrExpr));
}
/**
* Helper method used by other methods for traversing the next step
* of given path expression, and returning matching value node if any:
* if no match, {@code null} is returned.
*
* @param ptr Path expression to use
*
* @return Either matching {@link JsonNode} for the first step of path or
* {@code null} if no match (including case that this node is not a container)
*/
protected abstract JsonNode _at(JsonPointer ptr);
/*
/**********************************************************
/* Public API, type introspection
/**********************************************************
*/
// // First high-level division between values, containers and "missing"
/**
* Return the type of this node
*
* @return the node type as a {@link JsonNodeType} enum value
*
* @since 2.2
*/
public abstract JsonNodeType getNodeType();
/**
* Method that can be used to check if the node is a wrapper
* for a POJO ("Plain Old Java Object" aka "bean".
* Returns true only for
* instances of <code>POJONode</code>.
*
* @return True if this node wraps a POJO
*/
public final boolean isPojo() {
return getNodeType() == JsonNodeType.POJO;
}
/**
* @return True if this node represents a numeric JSON value
*/
public final boolean isNumber() {
return getNodeType() == JsonNodeType.NUMBER;
}
/**
*
* @return True if this node represents an integral (integer)
* numeric JSON value
*/
public boolean isIntegralNumber() { return false; }
/**
* @return True if this node represents a non-integral
* numeric JSON value
*/
public boolean isFloatingPointNumber() { return false; }
/**
* Method that can be used to check whether contained value
* is a number represented as Java <code>short</code>.
* Note, however, that even if this method returns false, it
* is possible that conversion would be possible from other numeric
* types -- to check if this is possible, use
* {@link #canConvertToInt()} instead.
*
* @return True if the value contained by this node is stored as Java short
*/
public boolean isShort() { return false; }
/**
* Method that can be used to check whether contained value
* is a number represented as Java <code>int</code>.
* Note, however, that even if this method returns false, it
* is possible that conversion would be possible from other numeric
* types -- to check if this is possible, use
* {@link #canConvertToInt()} instead.
*
* @return True if the value contained by this node is stored as Java int
*/
public boolean isInt() { return false; }
/**
* Method that can be used to check whether contained value
* is a number represented as Java <code>long</code>.
* Note, however, that even if this method returns false, it
* is possible that conversion would be possible from other numeric
* types -- to check if this is possible, use
* {@link #canConvertToLong()} instead.
*
* @return True if the value contained by this node is stored as Java <code>long</code>
*/
public boolean isLong() { return false; }
/**
* @since 2.2
*/
public boolean isFloat() { return false; }
public boolean isDouble() { return false; }
public boolean isBigDecimal() { return false; }
public boolean isBigInteger() { return false; }
/**
* Method that checks whether this node represents basic JSON String
* value.
*/
public final boolean isTextual() {
return getNodeType() == JsonNodeType.STRING;
}
/**
* Method that can be used to check if this node was created from
* JSON boolean value (literals "true" and "false").
*/
public final boolean isBoolean() {
return getNodeType() == JsonNodeType.BOOLEAN;
}
/**
* Method that can be used to check if this node was created from
* JSON literal null value.
*/
public final boolean isNull() {
return getNodeType() == JsonNodeType.NULL;
}
/**
* Method that can be used to check if this node represents
* binary data (Base64 encoded). Although this will be externally
* written as JSON String value, {@link #isTextual} will
* return false if this method returns true.
*
* @return True if this node represents base64 encoded binary data
*/
public final boolean isBinary() {
return getNodeType() == JsonNodeType.BINARY;
}
/**
* Method that can be used to check whether this node is a numeric
* node ({@link #isNumber} would return true) AND its value fits
* within Java's 32-bit signed integer type, <code>int</code>.
* Note that floating-point numbers are convertible if the integral
* part fits without overflow (as per standard Java coercion rules)
*<p>
* NOTE: this method does not consider possible value type conversion
* from JSON String into Number; so even if this method returns false,
* it is possible that {@link #asInt} could still succeed
* if node is a JSON String representing integral number, or boolean.
*
* @since 2.0
*/
public boolean canConvertToInt() { return false; }
/**
* Method that can be used to check whether this node is a numeric
* node ({@link #isNumber} would return true) AND its value fits
* within Java's 64-bit signed integer type, <code>long</code>.
* Note that floating-point numbers are convertible if the integral
* part fits without overflow (as per standard Java coercion rules)
*<p>
* NOTE: this method does not consider possible value type conversion
* from JSON String into Number; so even if this method returns false,
* it is possible that {@link #asLong} could still succeed
* if node is a JSON String representing integral number, or boolean.
*
* @since 2.0
*/
public boolean canConvertToLong() { return false; }
/**
* Method that can be used to check whether contained value
* is numeric (returns true for {@link #isNumber()}) and
* can be losslessly converted to integral number (specifically,
* {@link BigInteger} but potentially others, see
* {@link #canConvertToInt} and {@link #canConvertToInt}).
* Latter part allows floating-point numbers
* (for which {@link #isFloatingPointNumber()} returns {@code true})
* that do not have fractional part.
* Note that "not-a-number" values of {@code double} and {@code float}
* will return {@code false} as they can not be converted to matching
* integral representations.
*
* @return True if the value is an actual number with no fractional
* part; false for non-numeric types, NaN representations of floating-point
* numbers, and floating-point numbers with fractional part.
*
* @since 2.12
*/
public boolean canConvertToExactIntegral() {
return isIntegralNumber();
}
/*
/**********************************************************
/* Public API, straight value access
/**********************************************************
*/
/**
* Method to use for accessing String values.
* Does <b>NOT</b> do any conversions for non-String value nodes;
* for non-String values (ones for which {@link #isTextual} returns
* false) null will be returned.
* For String values, null is never returned (but empty Strings may be)
*
* @return Textual value this node contains, iff it is a textual
* JSON node (comes from JSON String value entry)
*/
public String textValue() { return null; }
/**
* Method to use for accessing binary content of binary nodes (nodes
* for which {@link #isBinary} returns true); or for Text Nodes
* (ones for which {@link #textValue} returns non-null value),
* to read decoded base64 data.
* For other types of nodes, returns null.
*
* @return Binary data this node contains, iff it is a binary
* node; null otherwise
*/
public byte[] binaryValue() throws IOException {
return null;
}
/**
* Method to use for accessing JSON boolean values (value
* literals 'true' and 'false').
* For other types, always returns false.
*
* @return Textual value this node contains, iff it is a textual
* json node (comes from JSON String value entry)
*/
public boolean booleanValue() { return false; }
/**
* Returns numeric value for this node, <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true); otherwise
* returns null
*
* @return Number value this node contains, if any (null for non-number
* nodes).
*/
public Number numberValue() { return null; }
/**
* Returns 16-bit short value for this node, <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns 0.
* For floating-point numbers, value is truncated using default
* Java coercion, similar to how cast from double to short operates.
*
* @return Short value this node contains, if any; 0 for non-number
* nodes.
*/
public short shortValue() { return 0; }
/**
* Returns integer value for this node, <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns 0.
* For floating-point numbers, value is truncated using default
* Java coercion, similar to how cast from double to int operates.
*
* @return Integer value this node contains, if any; 0 for non-number
* nodes.
*/
public int intValue() { return 0; }
/**
* Returns 64-bit long value for this node, <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns 0.
* For floating-point numbers, value is truncated using default
* Java coercion, similar to how cast from double to long operates.
*
* @return Long value this node contains, if any; 0 for non-number
* nodes.
*/
public long longValue() { return 0L; }
/**
* Returns 32-bit floating value for this node, <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns 0.0.
* For integer values, conversion is done using coercion; this means
* that an overflow is possible for `long` values
*
* @return 32-bit float value this node contains, if any; 0.0 for non-number nodes.
*
* @since 2.2
*/
public float floatValue() { return 0.0f; }
/**
* Returns 64-bit floating point (double) value for this node, <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns 0.0.
* For integer values, conversion is done using coercion; this may result
* in overflows with {@link BigInteger} values.
*
* @return 64-bit double value this node contains, if any; 0.0 for non-number nodes.
*
* @since 2.2
*/
public double doubleValue() { return 0.0; }
/**
* Returns floating point value for this node (as {@link BigDecimal}), <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns <code>BigDecimal.ZERO</code>.
*
* @return {@link BigDecimal} value this node contains, if numeric node; <code>BigDecimal.ZERO</code> for non-number nodes.
*/
public BigDecimal decimalValue() { return BigDecimal.ZERO; }
/**
* Returns integer value for this node (as {@link BigInteger}), <b>if and only if</b>
* this node is numeric ({@link #isNumber} returns true). For other
* types returns <code>BigInteger.ZERO</code>.
*
* @return {@link BigInteger} value this node contains, if numeric node; <code>BigInteger.ZERO</code> for non-number nodes.
*/
public BigInteger bigIntegerValue() { return BigInteger.ZERO; }
/*
/**********************************************************
/* Public API, value access with conversion(s)/coercion(s)
/**********************************************************
*/
/**
* Method that will return a valid String representation of
* the container value, if the node is a value node
* (method {@link #isValueNode} returns true),
* otherwise empty String.
*/
public abstract String asText();
/**
* Method similar to {@link #asText()}, except that it will return
* <code>defaultValue</code> in cases where null value would be returned;
* either for missing nodes (trying to access missing property, or element
* at invalid item for array) or explicit nulls.
*
* @since 2.4
*/
public String asText(String defaultValue) {
String str = asText();
return (str == null) ? defaultValue : str;
}
/**
* Method that will try to convert value of this node to a Java <b>int</b>.
* Numbers are coerced using default Java rules; booleans convert to 0 (false)
* and 1 (true), and Strings are parsed using default Java language integer
* parsing rules.
*<p>
* If representation cannot be converted to an int (including structured types
* like Objects and Arrays),
* default value of <b>0</b> will be returned; no exceptions are thrown.
*/
public int asInt() {
return asInt(0);
}
/**
* Method that will try to convert value of this node to a Java <b>int</b>.
* Numbers are coerced using default Java rules; booleans convert to 0 (false)
* and 1 (true), and Strings are parsed using default Java language integer
* parsing rules.
*<p>
* If representation cannot be converted to an int (including structured types
* like Objects and Arrays),
* specified <b>defaultValue</b> will be returned; no exceptions are thrown.
*/
public int asInt(int defaultValue) {
return defaultValue;
}
/**
* Method that will try to convert value of this node to a Java <b>long</b>.
* Numbers are coerced using default Java rules; booleans convert to 0 (false)
* and 1 (true), and Strings are parsed using default Java language integer
* parsing rules.
*<p>
* If representation cannot be converted to a long (including structured types
* like Objects and Arrays),
* default value of <b>0</b> will be returned; no exceptions are thrown.
*/
public long asLong() {
return asLong(0L);
}
/**
* Method that will try to convert value of this node to a Java <b>long</b>.
* Numbers are coerced using default Java rules; booleans convert to 0 (false)
* and 1 (true), and Strings are parsed using default Java language integer
* parsing rules.
*<p>
* If representation cannot be converted to a long (including structured types
* like Objects and Arrays),
* specified <b>defaultValue</b> will be returned; no exceptions are thrown.
*/
public long asLong(long defaultValue) {
return defaultValue;
}
/**
* Method that will try to convert value of this node to a Java <b>double</b>.
* Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
* and 1.0 (true), and Strings are parsed using default Java language integer
* parsing rules.
*<p>
* If representation cannot be converted to an int (including structured types
* like Objects and Arrays),
* default value of <b>0.0</b> will be returned; no exceptions are thrown.
*/
public double asDouble() {
return asDouble(0.0);
}
/**
* Method that will try to convert value of this node to a Java <b>double</b>.
* Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
* and 1.0 (true), and Strings are parsed using default Java language integer
* parsing rules.
*<p>
* If representation cannot be converted to an int (including structured types
* like Objects and Arrays),
* specified <b>defaultValue</b> will be returned; no exceptions are thrown.
*/
public double asDouble(double defaultValue) {
return defaultValue;
}
/**
* Method that will try to convert value of this node to a Java <b>boolean</b>.
* JSON booleans map naturally; integer numbers other than 0 map to true, and
* 0 maps to false
* and Strings 'true' and 'false' map to corresponding values.
*<p>
* If representation cannot be converted to a boolean value (including structured types
* like Objects and Arrays),
* default value of <b>false</b> will be returned; no exceptions are thrown.
*/
public boolean asBoolean() {
return asBoolean(false);
}
/**
* Method that will try to convert value of this node to a Java <b>boolean</b>.
* JSON booleans map naturally; integer numbers other than 0 map to true, and
* 0 maps to false
* and Strings 'true' and 'false' map to corresponding values.
*<p>
* If representation cannot be converted to a boolean value (including structured types
* like Objects and Arrays),
* specified <b>defaultValue</b> will be returned; no exceptions are thrown.
*/
public boolean asBoolean(boolean defaultValue) {
return defaultValue;
}
/*
/**********************************************************************
/* Public API, extended traversal (2.10) with "required()"
/**********************************************************************
*/
/**
* Method that may be called to verify that {@code this} node is NOT so-called
* "missing node": that is, one for which {@link #isMissingNode()} returns {@code true}.
* If not missing node, {@code this} is returned to allow chaining; otherwise
* {@link IllegalArgumentException} is thrown.
*
* @return {@code this} node to allow chaining
*
* @throws IllegalArgumentException if this node is "missing node"
*
* @since 2.10
*/
public <T extends JsonNode> T require() throws IllegalArgumentException {
return _this();
}
/**
* Method that may be called to verify that {@code this} node is neither so-called
* "missing node" (that is, one for which {@link #isMissingNode()} returns {@code true})
* nor "null node" (one for which {@link #isNull()} returns {@code true}).
* If non-null non-missing node, {@code this} is returned to allow chaining; otherwise
* {@link IllegalArgumentException} is thrown.
*
* @return {@code this} node to allow chaining
*
* @throws IllegalArgumentException if this node is either "missing node" or "null node"
*
* @since 2.10
*/
public <T extends JsonNode> T requireNonNull() throws IllegalArgumentException {
return _this();
}
/**
* Method is functionally equivalent to
*{@code
* path(fieldName).required()
*}
* and can be used to check that this node is an {@code ObjectNode} (that is, represents
* JSON Object value) and has value for specified property with key {@code fieldName}
* (but note that value may be explicit JSON null value).
* If this node is Object Node and has value for specified property, matching value
* is returned; otherwise {@link IllegalArgumentException} is thrown.
*
* @param propertyName Name of property to access
*
* @return Value of the specified property of this Object node
*
* @throws IllegalArgumentException if this node is not an Object node or if it does not
* have value for specified property
*
* @since 2.10
*/
public JsonNode required(String propertyName) throws IllegalArgumentException {
return _reportRequiredViolation("Node of type `%s` has no fields", getClass().getName());
}
/**
* Method is functionally equivalent to
*{@code
* path(index).required()
*}
* and can be used to check that this node is an {@code ArrayNode} (that is, represents
* JSON Array value) and has value for specified {@code index}
* (but note that value may be explicit JSON null value).
* If this node is Array Node and has value for specified index, value at index
* is returned; otherwise {@link IllegalArgumentException} is thrown.
*
* @param index Index of the value of this Array node to access
*
* @return Value at specified index of this Array node
*
* @throws IllegalArgumentException if this node is not an Array node or if it does not
* have value for specified index
*
* @since 2.10
*/
public JsonNode required(int index) throws IllegalArgumentException {
return _reportRequiredViolation("Node of type `%s` has no indexed values", getClass().getName());
}
/**
* Method is functionally equivalent to
*{@code
* at(pathExpr).required()
*}
* and can be used to check that there is an actual value node at specified {@link JsonPointer}
* starting from {@code this} node
* (but note that value may be explicit JSON null value).
* If such value node exists it is returned;
* otherwise {@link IllegalArgumentException} is thrown.
*
* @param pathExpr {@link JsonPointer} expression (as String) to use for finding value node
*
* @return Matching value node for given expression
*
* @throws IllegalArgumentException if no value node exists at given {@code JSON Pointer} path
*
* @since 2.10
*/
public JsonNode requiredAt(String pathExpr) throws IllegalArgumentException {
return requiredAt(JsonPointer.compile(pathExpr));
}
/**
* Method is functionally equivalent to
*{@code
* at(path).required()
*}
* and can be used to check that there is an actual value node at specified {@link JsonPointer}
* starting from {@code this} node
* (but note that value may be explicit JSON null value).
* If such value node exists it is returned;
* otherwise {@link IllegalArgumentException} is thrown.
*
* @param path {@link JsonPointer} expression to use for finding value node
*
* @return Matching value node for given expression
*
* @throws IllegalArgumentException if no value node exists at given {@code JSON Pointer} path
*
* @since 2.10
*/
public final JsonNode requiredAt(final JsonPointer path) throws IllegalArgumentException {
JsonPointer currentExpr = path;
JsonNode curr = this;
// Note: copied from `at()`
while (true) {
if (currentExpr.matches()) {
return curr;
}
curr = curr._at(currentExpr); // lgtm [java/dereferenced-value-may-be-null]
if (curr == null) {
_reportRequiredViolation("No node at '%s' (unmatched part: '%s')",
path, currentExpr);
}
currentExpr = currentExpr.tail();
}
}
/*
/**********************************************************
/* Public API, value find / existence check methods
/**********************************************************
*/
/**
* Method that allows checking whether this node is JSON Object node
* and contains value for specified property. If this is the case
* (including properties with explicit null values), returns true;
* otherwise returns false.
*<p>
* This method is equivalent to:
*<pre>
* node.get(fieldName) != null
*</pre>
* (since return value of get() is node, not value node contains)
*<p>
* NOTE: when explicit <code>null</code> values are added, this
* method will return <code>true</code> for such properties.
*
* @param fieldName Name of element to check
*
* @return True if this node is a JSON Object node, and has a property
* entry with specified name (with any value, including null value)
*/
public boolean has(String fieldName) {
return get(fieldName) != null;
}
/**
* Method that allows checking whether this node is JSON Array node
* and contains a value for specified index
* If this is the case
* (including case of specified indexing having null as value), returns true;
* otherwise returns false.
*<p>
* Note: array element indexes are 0-based.
*<p>
* This method is equivalent to:
*<pre>
* node.get(index) != null
*</pre>
*<p>
* NOTE: this method will return <code>true</code> for explicitly added
* null values.
*
* @param index Index to check
*
* @return True if this node is a JSON Object node, and has a property
* entry with specified name (with any value, including null value)
*/
public boolean has(int index) {
return get(index) != null;
}
/**
* Method that is similar to {@link #has(String)}, but that will
* return <code>false</code> for explicitly added nulls.
*<p>
* This method is functionally equivalent to:
*<pre>
* node.get(fieldName) != null && !node.get(fieldName).isNull()
*</pre>
*
* @since 2.1
*/
public boolean hasNonNull(String fieldName) {
JsonNode n = get(fieldName);
return (n != null) && !n.isNull();
}
/**
* Method that is similar to {@link #has(int)}, but that will
* return <code>false</code> for explicitly added nulls.
*<p>
* This method is equivalent to:
*<pre>
* node.get(index) != null && !node.get(index).isNull()
*</pre>
*
* @since 2.1
*/
public boolean hasNonNull(int index) {
JsonNode n = get(index);
return (n != null) && !n.isNull();
}
/*
/**********************************************************
/* Public API, container access
/**********************************************************
*/
/**
* Same as calling {@link #elements}; implemented so that
* convenience "for-each" loop can be used for looping over elements
* of JSON Array constructs.
*/
@Override
public final Iterator<JsonNode> iterator() { return elements(); }
/**
* Method for accessing all value nodes of this Node, iff
* this node is a JSON Array or Object node. In case of Object node,
* field names (keys) are not included, only values.
* For other types of nodes, returns empty iterator.
*/
public Iterator<JsonNode> elements() {
return ClassUtil.emptyIterator();
}
/**
* @return Iterator that can be used to traverse all key/value pairs for
* object nodes; empty iterator (no contents) for other types
*/
public Iterator<Map.Entry<String, JsonNode>> fields() {
return ClassUtil.emptyIterator();
}
/*
/**********************************************************
/* Public API, find methods
/**********************************************************
*/
/**
* Method for finding a JSON Object field with specified name in this
* node or its child nodes, and returning value it has.
* If no matching field is found in this node or its descendants, returns null.
*
* @param fieldName Name of field to look for
*
* @return Value of first matching node found, if any; null if none
*/
public abstract JsonNode findValue(String fieldName);
/**
* Method for finding JSON Object fields with specified name, and returning
* found ones as a List. Note that sub-tree search ends if a field is found,
* so possible children of result nodes are <b>not</b> included.
* If no matching fields are found in this node or its descendants, returns
* an empty List.
*
* @param fieldName Name of field to look for
*/
public final List<JsonNode> findValues(String fieldName)
{
List<JsonNode> result = findValues(fieldName, null);
if (result == null) {
return Collections.emptyList();
}
return result;
}
/**
* Similar to {@link #findValues}, but will additionally convert
* values into Strings, calling {@link #asText}.
*/
public final List<String> findValuesAsText(String fieldName)
{
List<String> result = findValuesAsText(fieldName, null);
if (result == null) {
return Collections.emptyList();
}
return result;
}
/**
* Method similar to {@link #findValue}, but that will return a
* "missing node" instead of null if no field is found. Missing node
* is a specific kind of node for which {@link #isMissingNode}
* returns true; and all value access methods return empty or
* missing value.
*
* @param fieldName Name of field to look for
*
* @return Value of first matching node found; or if not found, a
* "missing node" (non-null instance that has no value)
*/
public abstract JsonNode findPath(String fieldName);
/**
* Method for finding a JSON Object that contains specified field,
* within this node or its descendants.
* If no matching field is found in this node or its descendants, returns null.
*
* @param fieldName Name of field to look for
*
* @return Value of first matching node found, if any; null if none
*/
public abstract JsonNode findParent(String fieldName);
/**
* Method for finding a JSON Object that contains specified field,
* within this node or its descendants.
* If no matching field is found in this node or its descendants, returns null.
*
* @param fieldName Name of field to look for
*
* @return Value of first matching node found, if any; null if none
*/
public final List<JsonNode> findParents(String fieldName)
{
List<JsonNode> result = findParents(fieldName, null);
if (result == null) {
return Collections.emptyList();
}
return result;
}
public abstract List<JsonNode> findValues(String fieldName, List<JsonNode> foundSoFar);
public abstract List<String> findValuesAsText(String fieldName, List<String> foundSoFar);
public abstract List<JsonNode> findParents(String fieldName, List<JsonNode> foundSoFar);
/*
/**********************************************************
/* Public API, path handling
/**********************************************************
*/
/**
* Short-cut equivalent to:
*<pre>
* withObject(JsonPointer.compile(expr);
*</pre>
* see {@link #withObject(JsonPointer)} for full explanation.
*
* @param expr {@link JsonPointer} expression to use
*
* @return {@link ObjectNode} found or created
*
* @since 2.14
*/
public final ObjectNode withObject(String expr) {
return withObject(JsonPointer.compile(expr));
}
/**
* Short-cut equivalent to:
*<pre>
* withObject(JsonPointer.compile(expr), overwriteMode, preferIndex);
*</pre>
*
* @since 2.14
*/
public final ObjectNode withObject(String expr,
OverwriteMode overwriteMode, boolean preferIndex) {
return withObject(JsonPointer.compile(expr), overwriteMode, preferIndex);
}
/**
* Same as {@link #withObject(JsonPointer, OverwriteMode, boolean)} but
* with defaults of {@code OvewriteMode#NULLS} (overwrite mode)
* and {@code true} for {@code preferIndex} (that is, will try to
* consider {@link JsonPointer} segments index if at all possible
* and only secondarily as property name
*
* @param ptr {@link JsonPointer} that indicates path to use for Object value to return
* (potentially creating as necessary)
*
* @return {@link ObjectNode} found or created
*
* @since 2.14
*/
public final ObjectNode withObject(JsonPointer ptr) {
return withObject(ptr, OverwriteMode.NULLS, true);
}
/**
* Method that can be called on Object or Array nodes, to access a Object-valued
* node pointed to by given {@link JsonPointer}, if such a node exists:
* or if not, an attempt is made to create one and return it.
* For example, on document
*<pre>
* { "a" : {
* "b" : {
* "c" : 13
* }
* }
* }
*</pre>
* calling method with {@link JsonPointer} of {@code /a/b} would return
* {@link ObjectNode}
*<pre>
* { "c" : 13 }
*</pre>
*<p>
* In cases where path leads to "missing" nodes, a path is created.
* So, for example, on above document, and
* {@link JsonPointer} of {@code /a/x} an empty {@link ObjectNode} would
* be returned and the document would look like:
*<pre>
* { "a" : {
* "b" : {
* "c" : 13
* },
* "x" : { }
* }
* }
*</pre>
* Finally, if the path is incompatible with the document -- there is an existing
* {@code JsonNode} through which expression cannot go -- a replacement is
* attempted if (and only if) conversion is allowed as per {@code overwriteMode}
* passed in. For example, with above document and expression of {@code /a/b/c},
* conversion is allowed if passing {@code OverwriteMode.SCALARS} or
* {@code OvewriteMode.ALL}, and resulting document would look like:
*<pre>
* { "a" : {
* "b" : {
* "c" : { }
* },
* "x" : { }
* }
* }
*</pre>
* but if different modes ({@code NONE} or {@code NULLS}) is passed, an exception
* is thrown instead.
*
* @param ptr Pointer that indicates path to use for {@link ObjectNode} value to return
* (potentially creating one as necessary)
* @param overwriteMode Defines which node types may be converted in case of
* incompatible {@code JsonPointer} expression: if conversion not allowed,
* {@link UnsupportedOperationException} is thrown.
* @param preferIndex When creating a path (for empty or replacement), and path
* contains segment that may be an array index (simple integer number like
* {@code 3}), whether to construct an {@link ArrayNode} ({@code true}) or
* {@link ObjectNode} ({@code false}). In latter case matching property with
* quoted number (like {@code "3"}) is used within Object.
*
* @return {@link ObjectNode} found or created
*
* @throws UnsupportedOperationException if a conversion would be needed for given
* {@code JsonPointer}, document, but was not allowed for the type encountered
*
* @since 2.14
*/
public ObjectNode withObject(JsonPointer ptr,
OverwriteMode overwriteMode, boolean preferIndex) {
// To avoid abstract method, base implementation just fails
throw new UnsupportedOperationException("`withObject(JsonPointer)` not implemented by `"
+getClass().getName()+"`");
}
/**
* Method that works in one of possible ways, depending on whether
* {@code exprOrProperty} is a valid {@link JsonPointer} expression or
* not (valid expression is either empty String {@code ""} or starts
* with leading slash {@code /} character).
* If it is, works as a short-cut to:
*<pre>
* withObject(JsonPointer.compile(exprOrProperty));
*</pre>
* If it is NOT a valid {@link JsonPointer} expression, value is taken
* as a literal Object property name and traversed like a single-segment
* {@link JsonPointer}.
*<p>
* NOTE: before Jackson 2.14 behavior was always that of non-expression usage;
* that is, {@code exprOrProperty} was always considered as a simple property name.
*
* @deprecated Since 2.14 use {@code withObject(String)} instead
*/
@Deprecated // since 2.14
public <T extends JsonNode> T with(String exprOrProperty) {
throw new UnsupportedOperationException("`JsonNode` not of type `ObjectNode` (but "
+getClass().getName()+"), cannot call `with(String)` on it");
}
/**
* Method that works in one of possible ways, depending on whether
* {@code exprOrProperty} is a valid {@link JsonPointer} expression or
* not (valid expression is either empty String {@code ""} or starts
* with leading slash {@code /} character).
* If it is, works as a short-cut to:
*<pre>
* withObject(JsonPointer.compile(exprOrProperty));
*</pre>
* If it is NOT a valid {@link JsonPointer} expression, value is taken
* as a literal Object property name and traversed like a single-segment
* {@link JsonPointer}.
*<p>
* NOTE: before Jackson 2.14 behavior was always that of non-expression usage;
* that is, {@code exprOrProperty} was always considered as a simple property name.
*
* @param exprOrProperty Either {@link JsonPointer} expression for full access (if valid
* pointer expression), or the name of property for the {@link ArrayNode}.
*
* @return {@link ArrayNode} found or created
*/
public <T extends JsonNode> T withArray(String exprOrProperty) {
throw new UnsupportedOperationException("`JsonNode` not of type `ObjectNode` (but `"
+getClass().getName()+")`, cannot call `withArray()` on it");
}
/**
* Short-cut equivalent to:
*<pre>
* withArray(JsonPointer.compile(expr), overwriteMode, preferIndex);
*</pre>
*
* @since 2.14
*/
public ArrayNode withArray(String expr,
OverwriteMode overwriteMode, boolean preferIndex) {
return withArray(JsonPointer.compile(expr), overwriteMode, preferIndex);
}
/**
* Same as {@link #withArray(JsonPointer, OverwriteMode, boolean)} but
* with defaults of {@code OvewriteMode#NULLS} (overwrite mode)
* and {@code true} for {@code preferIndex}.
*
* @param ptr Pointer that indicates path to use for {@link ArrayNode} to return
* (potentially creating as necessary)
*
* @return {@link ArrayNode} found or created
*
* @since 2.14
*/
public final ArrayNode withArray(JsonPointer ptr) {
return withArray(ptr, OverwriteMode.NULLS, true);
}
/**
* Method that can be called on Object or Array nodes, to access a Array-valued
* node pointed to by given {@link JsonPointer}, if such a node exists:
* or if not, an attempt is made to create one and return it.
* For example, on document
*<pre>
* { "a" : {
* "b" : [ 1, 2 ]
* }
* }
*</pre>
* calling method with {@link JsonPointer} of {@code /a/b} would return
* {@code Array}
*<pre>
* [ 1, 2 ]
*</pre>
*<p>
* In cases where path leads to "missing" nodes, a path is created.
* So, for example, on above document, and
* {@link JsonPointer} of {@code /a/x} an empty {@code ArrayNode} would
* be returned and the document would look like:
*<pre>
* { "a" : {
* "b" : [ 1, 2 ],
* "x" : [ ]
* }
* }
*</pre>
* Finally, if the path is incompatible with the document -- there is an existing
* {@code JsonNode} through which expression cannot go -- a replacement is
* attempted if (and only if) conversion is allowed as per {@code overwriteMode}
* passed in. For example, with above document and expression of {@code /a/b/0},
* conversion is allowed if passing {@code OverwriteMode.SCALARS} or
* {@code OvewriteMode.ALL}, and resulting document would look like:
*<pre>
* { "a" : {
* "b" : [ [ ], 2 ],
* "x" : [ ]
* }
* }
*</pre>
* but if different modes ({@code NONE} or {@code NULLS}) is passed, an exception
* is thrown instead.
*
* @param ptr Pointer that indicates path to use for {@link ArrayNode} value to return
* (potentially creating it as necessary)
* @param overwriteMode Defines which node types may be converted in case of
* incompatible {@code JsonPointer} expression: if conversion not allowed,
* an exception is thrown.
* @param preferIndex When creating a path (for empty or replacement), and path
* contains segment that may be an array index (simple integer number like
* {@code 3}), whether to construct an {@link ArrayNode} ({@code true}) or
* {@link ObjectNode} ({@code false}). In latter case matching property with
* quoted number (like {@code "3"}) is used within Object.
*
* @return {@link ArrayNode} found or created
*
* @throws UnsupportedOperationException if a conversion would be needed for given
* {@code JsonPointer}, document, but was not allowed for the type encountered
*
* @since 2.14
*/
public ArrayNode withArray(JsonPointer ptr,
OverwriteMode overwriteMode, boolean preferIndex) {
// To avoid abstract method, base implementation just fails
throw new UnsupportedOperationException("`withArray(JsonPointer)` not implemented by "
+getClass().getName());
}
/*
/**********************************************************
/* Public API, comparison
/**********************************************************
*/
/**
* Entry method for invoking customizable comparison, using passed-in
* {@link Comparator} object. Nodes will handle traversal of structured
* types (arrays, objects), but defer to comparator for scalar value
* comparisons. If a "natural" {@link Comparator} is passed -- one that
* simply calls <code>equals()</code> on one of arguments, passing the other
* -- implementation is the same as directly calling <code>equals()</code>
* on node.
*<p>
* Default implementation simply delegates to passed in <code>comparator</code>,
* with <code>this</code> as the first argument, and <code>other</code> as
* the second argument.
*
* @param comparator Object called to compare two scalar {@link JsonNode}
* instances, and return either 0 (are equals) or non-zero (not equal)
*
* @since 2.6
*/
public boolean equals(Comparator<JsonNode> comparator, JsonNode other) {
return comparator.compare(this, other) == 0;
}
/*
/**********************************************************
/* Overridden standard methods
/**********************************************************
*/
/**
* Method that will produce (as of Jackson 2.10) valid JSON using
* default settings of databind, as String.
* If you want other kinds of JSON output (or output formatted using one of
* other Jackson-supported data formats) make sure to use
* {@link ObjectMapper} or {@link ObjectWriter} to serialize an
* instance, for example:
*<pre>
* String json = objectMapper.writeValueAsString(rootNode);
*</pre>
*<p>
* Note: method defined as abstract to ensure all implementation
* classes explicitly implement method, instead of relying
* on {@link Object#toString()} definition.
*/
@Override
public abstract String toString();
/**
* Alternative to {@link #toString} that will serialize this node using
* Jackson default pretty-printer.
*
* @since 2.10
*/
public String toPrettyString() {
return toString();
}
/**
* Equality for node objects is defined as full (deep) value
* equality. This means that it is possible to compare complete
* JSON trees for equality by comparing equality of root nodes.
*<p>
* Note: marked as abstract to ensure all implementation
* classes define it properly and not rely on definition
* from {@link java.lang.Object}.
*/
@Override
public abstract boolean equals(Object o);
/*
/**********************************************************************
/* Helper methods, for sub-classes
/**********************************************************************
*/
// @since 2.10
@SuppressWarnings("unchecked")
protected <T extends JsonNode> T _this() {
return (T) this;
}
/**
* Helper method that throws {@link IllegalArgumentException} as a result of
* violating "required-constraint" for this node (for {@link #required} or related
* methods).
*/
protected <T> T _reportRequiredViolation(String msgTemplate, Object...args) {
throw new IllegalArgumentException(String.format(msgTemplate, args));
}
}
⏎ com/fasterxml/jackson/databind/JsonNode.java
Or download all of them as a single archive file:
File name: jackson-databind-2.14.0-sources.jar File size: 1187952 bytes Release date: 2022-11-05 Download
⇒ Jackson Annotations Source Code
⇐ Download and Install Jackson Binary Package
2022-03-29, ≈229🔥, 0💬
Popular Posts:
If you are a Java developer, it is very often that you need to use some 3rd party libraries to perfo...
JDK 17 jdk.crypto.cryptoki.jmod is the JMOD file for JDK 17 Crypto Cryptoki module. JDK 17 Crypto KI...
JDK 11 jdk.crypto.mscapi.jmod is the JMOD file for JDK 11 Crypto MSCAPI module. JDK 11 Crypto MSCAPI...
JDK 17 jdk.incubator.vector.jmo dis the JMOD file for JDK 17 HTTP Server module. JDK 17 Incubator Ve...
How to read XML document with DTD validation from socket connections with the socket\DelayedInput.ja.. .