Jackson Data Binding Source Code

Jackson is "the Java JSON library" or "the best JSON parser for Java". Or simply as "JSON for Java".

  • Jackson Data Binding module allows you to converts JSON to and from POJO (Plain Old Java Object) using property accessor or using annotations.
  • Jackson Databind Source Code files are provided in the source packge (jackson-databind-2.14.0-sources.jar). You can download it at Jackson Maven Website.

    You can also browse Jackson Databind Source Code below:

    ✍: FYIcenter.com


    package com.fasterxml.jackson.databind;
    import java.io.IOException;
    import java.math.BigDecimal;
    import java.math.BigInteger;
    import java.util.*;
    import com.fasterxml.jackson.core.*;
    import com.fasterxml.jackson.databind.node.ArrayNode;
    import com.fasterxml.jackson.databind.node.JsonNodeType;
    import com.fasterxml.jackson.databind.node.MissingNode;
    import com.fasterxml.jackson.databind.node.ObjectNode;
    import com.fasterxml.jackson.databind.util.ClassUtil;
     * Base class for all JSON nodes, which form the basis of JSON
     * Tree Model that Jackson implements.
     * One way to think of these nodes is to consider them
     * similar to DOM nodes in XML DOM trees.
     * As a general design rule, most accessors ("getters") are included
     * in this base class, to allow for traversing structure without
     * type casts. Most mutators, however, need to be accessed through
     * specific sub-classes (such as <code>ObjectNode</code>
     * and <code>ArrayNode</code>).
     * This seems sensible because proper type
     * information is generally available when building or modifying
     * trees, but less often when reading a tree (newly built from
     * parsed JSON content).
     * Actual concrete sub-classes can be found from package
     * {@link com.fasterxml.jackson.databind.node}.
     * Note that it is possible to "read" from nodes, using
     * method {@link TreeNode#traverse(ObjectCodec)}, which will result in
     * a {@link JsonParser} being constructed. This can be used for (relatively)
     * efficient conversations between different representations; and it is what
     * core databind uses for methods like {@link ObjectMapper#treeToValue(TreeNode, Class)}
     * and {@link ObjectMapper#treeAsTokens(TreeNode)}
    public abstract class JsonNode
        extends JsonSerializable.Base // i.e. implements JsonSerializable
        implements TreeNode, Iterable<JsonNode>
         * Configuration setting used with {@link JsonNode#withObject(JsonPointer)}
         * method overrides, to indicate which overwrites are acceptable if the
         * path pointer indicates has incompatible nodes (for example, instead
         * of Object node a Null node is encountered).
         * Overwrite means that the existing value is replaced with compatible type,
         * potentially losing existing values or even sub-trees.
         * Default value if {@code NULLS} which only allows Null-value nodes
         * to be replaced but no other types.
         * @since 2.14
        public enum OverwriteMode {
             * Mode in which no values may be overwritten, not even {@code NullNode}s;
             * only compatible paths may be traversed.
             * Mode in which explicit {@code NullNode}s may be replaced but no other
             * node types. 
             * Mode in which all scalar value nodes may be replaced, but not
             * Array or Object nodes.
             * Mode in which all incompatible node types may be replaced, including
             * Array and Object nodes where necessary.
        /* Construction, related
        protected JsonNode() { }
         * Method that can be called to get a node that is guaranteed
         * not to allow changing of this node through mutators on
         * this node or any of its children.
         * This means it can either make a copy of this node (and all
         * mutable children and grand children nodes), or node itself
         * if it is immutable.
         * Note: return type is guaranteed to have same type as the
         * node method is called on; which is why method is declared
         * with local generic type.
         * @since 2.0
         * @return Node that is either a copy of this node (and all non-leaf
         *    children); or, for immutable leaf nodes, node itself.
        public abstract <T extends JsonNode> T deepCopy();
        /* TreeNode implementation
    //  public abstract JsonToken asToken();
    //  public abstract JsonToken traverse();
    //  public abstract JsonToken traverse(ObjectCodec codec);
    //  public abstract JsonParser.NumberType numberType();
        public int size() { return 0; }
         * Convenience method that is functionally same as:
         *    size() == 0
         * for all node types.
         * @since 2.10
        public boolean isEmpty() { return size() == 0; }
        public final boolean isValueNode()
            switch (getNodeType()) {
                case ARRAY: case OBJECT: case MISSING:
                    return false;
                    return true;
        public final boolean isContainerNode() {
            final JsonNodeType type = getNodeType();
            return type == JsonNodeType.OBJECT || type == JsonNodeType.ARRAY;
        public boolean isMissingNode() {
            return false;
        public boolean isArray() {
            return false;
        public boolean isObject() {
            return false;
         * Method for accessing value of the specified element of
         * an array node. For other nodes, null is always returned.
         * For array nodes, index specifies
         * exact location within array and allows for efficient iteration
         * over child elements (underlying storage is guaranteed to
         * be efficiently indexable, i.e. has random-access to elements).
         * If index is less than 0, or equal-or-greater than
         * <code>node.size()</code>, null is returned; no exception is
         * thrown for any index.
         * NOTE: if the element value has been explicitly set as <code>null</code>
         * (which is different from removal!),
         * a {@link com.fasterxml.jackson.databind.node.NullNode} will be returned,
         * not null.
         * @return Node that represent value of the specified element,
         *   if this node is an array and has specified element.
         *   Null otherwise.
        public abstract JsonNode get(int index);
         * Method for accessing value of the specified field of
         * an object node. If this node is not an object (or it
         * does not have a value for specified field name), or
         * if there is no field with such name, null is returned.
         * NOTE: if the property value has been explicitly set as <code>null</code>
         * (which is different from removal!),
         * a {@link com.fasterxml.jackson.databind.node.NullNode} will be returned,
         * not null.
         * @return Node that represent value of the specified field,
         *   if this node is an object and has value for the specified
         *   field. Null otherwise.
        public JsonNode get(String fieldName) { return null; }
         * This method is similar to {@link #get(String)}, except
         * that instead of returning null if no such value exists (due
         * to this node not being an object, or object not having value
         * for the specified field),
         * a "missing node" (node that returns true for
         * {@link #isMissingNode}) will be returned. This allows for
         * convenient and safe chained access via path calls.
        public abstract JsonNode path(String fieldName);
         * This method is similar to {@link #get(int)}, except
         * that instead of returning null if no such element exists (due
         * to index being out of range, or this node not being an array),
         * a "missing node" (node that returns true for
         * {@link #isMissingNode}) will be returned. This allows for
         * convenient and safe chained access via path calls.
        public abstract JsonNode path(int index);
        public Iterator<String> fieldNames() {
            return ClassUtil.emptyIterator();
         * Method for locating node specified by given JSON pointer instances.
         * Method will never return null; if no matching node exists, 
         *   will return a node for which {@link #isMissingNode()} returns true.
         * @return Node that matches given JSON Pointer: if no match exists,
         *   will return a node for which {@link #isMissingNode()} returns true.
         * @since 2.3
        public final JsonNode at(JsonPointer ptr)
            // Basically: value nodes only match if we have "empty" path left
            if (ptr.matches()) {
                return this;
            JsonNode n = _at(ptr);
            if (n == null) {
                return MissingNode.getInstance();
            return n.at(ptr.tail());
         * Convenience method that is functionally equivalent to:
         *   return at(JsonPointer.valueOf(jsonPointerExpression));
         * Note that if the same expression is used often, it is preferable to construct
         * {@link JsonPointer} instance once and reuse it: this method will not perform
         * any caching of compiled expressions.
         * @param jsonPtrExpr Expression to compile as a {@link JsonPointer}
         *   instance
         * @return Node that matches given JSON Pointer: if no match exists,
         *   will return a node for which {@link TreeNode#isMissingNode()} returns true.
         * @since 2.3
        public final JsonNode at(String jsonPtrExpr) {
            return at(JsonPointer.compile(jsonPtrExpr));
         * Helper method used by other methods for traversing the next step
         * of given path expression, and returning matching value node if any:
         * if no match, {@code null} is returned.
         * @param ptr Path expression to use
         * @return Either matching {@link JsonNode} for the first step of path or
         *    {@code null} if no match (including case that this node is not a container)
        protected abstract JsonNode _at(JsonPointer ptr);
        /* Public API, type introspection
        // // First high-level division between values, containers and "missing"
         * Return the type of this node
         * @return the node type as a {@link JsonNodeType} enum value
         * @since 2.2
        public abstract JsonNodeType getNodeType();
         * Method that can be used to check if the node is a wrapper
         * for a POJO ("Plain Old Java Object" aka "bean".
         * Returns true only for
         * instances of <code>POJONode</code>.
         * @return True if this node wraps a POJO
        public final boolean isPojo() {
            return getNodeType() == JsonNodeType.POJO;
         * @return True if this node represents a numeric JSON value
        public final boolean isNumber() {
            return getNodeType() == JsonNodeType.NUMBER;
         * @return True if this node represents an integral (integer)
         *   numeric JSON value
        public boolean isIntegralNumber() { return false; }
         * @return True if this node represents a non-integral
         *   numeric JSON value
        public boolean isFloatingPointNumber() { return false; }
         * Method that can be used to check whether contained value
         * is a number represented as Java <code>short</code>.
         * Note, however, that even if this method returns false, it
         * is possible that conversion would be possible from other numeric
         * types -- to check if this is possible, use
         * {@link #canConvertToInt()} instead.
         * @return True if the value contained by this node is stored as Java short
        public boolean isShort() { return false; }
         * Method that can be used to check whether contained value
         * is a number represented as Java <code>int</code>.
         * Note, however, that even if this method returns false, it
         * is possible that conversion would be possible from other numeric
         * types -- to check if this is possible, use
         * {@link #canConvertToInt()} instead.
         * @return True if the value contained by this node is stored as Java int
        public boolean isInt() { return false; }
         * Method that can be used to check whether contained value
         * is a number represented as Java <code>long</code>.
         * Note, however, that even if this method returns false, it
         * is possible that conversion would be possible from other numeric
         * types -- to check if this is possible, use
         * {@link #canConvertToLong()} instead.
         * @return True if the value contained by this node is stored as Java <code>long</code>
        public boolean isLong() { return false; }
         * @since 2.2
        public boolean isFloat() { return false; }
        public boolean isDouble() { return false; }
        public boolean isBigDecimal() { return false; }
        public boolean isBigInteger() { return false; }
         * Method that checks whether this node represents basic JSON String
         * value.
        public final boolean isTextual() {
            return getNodeType() == JsonNodeType.STRING;
         * Method that can be used to check if this node was created from
         * JSON boolean value (literals "true" and "false").
        public final boolean isBoolean() {
            return getNodeType() == JsonNodeType.BOOLEAN;
         * Method that can be used to check if this node was created from
         * JSON literal null value.
        public final boolean isNull() {
            return getNodeType() == JsonNodeType.NULL;
         * Method that can be used to check if this node represents
         * binary data (Base64 encoded). Although this will be externally
         * written as JSON String value, {@link #isTextual} will
         * return false if this method returns true.
         * @return True if this node represents base64 encoded binary data
        public final boolean isBinary() {
            return getNodeType() == JsonNodeType.BINARY;
         * Method that can be used to check whether this node is a numeric
         * node ({@link #isNumber} would return true) AND its value fits
         * within Java's 32-bit signed integer type, <code>int</code>.
         * Note that floating-point numbers are convertible if the integral
         * part fits without overflow (as per standard Java coercion rules)
         * NOTE: this method does not consider possible value type conversion
         * from JSON String into Number; so even if this method returns false,
         * it is possible that {@link #asInt} could still succeed
         * if node is a JSON String representing integral number, or boolean.
         * @since 2.0
        public boolean canConvertToInt() { return false; }
         * Method that can be used to check whether this node is a numeric
         * node ({@link #isNumber} would return true) AND its value fits
         * within Java's 64-bit signed integer type, <code>long</code>.
         * Note that floating-point numbers are convertible if the integral
         * part fits without overflow (as per standard Java coercion rules)
         * NOTE: this method does not consider possible value type conversion
         * from JSON String into Number; so even if this method returns false,
         * it is possible that {@link #asLong} could still succeed
         * if node is a JSON String representing integral number, or boolean.
         * @since 2.0
        public boolean canConvertToLong() { return false; }
         * Method that can be used to check whether contained value
         * is numeric (returns true for {@link #isNumber()}) and
         * can be losslessly converted to integral number (specifically,
         * {@link BigInteger} but potentially others, see
         * {@link #canConvertToInt} and {@link #canConvertToInt}).
         * Latter part allows floating-point numbers
         * (for which {@link #isFloatingPointNumber()} returns {@code true})
         * that do not have fractional part.
         * Note that "not-a-number" values of {@code double} and {@code float}
         * will return {@code false} as they can not be converted to matching
         * integral representations.
         * @return True if the value is an actual number with no fractional
         *    part; false for non-numeric types, NaN representations of floating-point
         *    numbers, and floating-point numbers with fractional part.
         * @since 2.12
        public boolean canConvertToExactIntegral() {
            return isIntegralNumber();
        /* Public API, straight value access
         * Method to use for accessing String values.
         * Does <b>NOT</b> do any conversions for non-String value nodes;
         * for non-String values (ones for which {@link #isTextual} returns
         * false) null will be returned.
         * For String values, null is never returned (but empty Strings may be)
         * @return Textual value this node contains, iff it is a textual
         *   JSON node (comes from JSON String value entry)
        public String textValue() { return null; }
         * Method to use for accessing binary content of binary nodes (nodes
         * for which {@link #isBinary} returns true); or for Text Nodes
         * (ones for which {@link #textValue} returns non-null value),
         * to read decoded base64 data.
         * For other types of nodes, returns null.
         * @return Binary data this node contains, iff it is a binary
         *   node; null otherwise
        public byte[] binaryValue() throws IOException {
            return null;
         * Method to use for accessing JSON boolean values (value
         * literals 'true' and 'false').
         * For other types, always returns false.
         * @return Textual value this node contains, iff it is a textual
         *   json node (comes from JSON String value entry)
        public boolean booleanValue() { return false; }
         * Returns numeric value for this node, <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true); otherwise
         * returns null
         * @return Number value this node contains, if any (null for non-number
         *   nodes).
        public Number numberValue() { return null; }
         * Returns 16-bit short value for this node, <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns 0.
         * For floating-point numbers, value is truncated using default
         * Java coercion, similar to how cast from double to short operates.
         * @return Short value this node contains, if any; 0 for non-number
         *   nodes.
        public short shortValue() { return 0; }
         * Returns integer value for this node, <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns 0.
         * For floating-point numbers, value is truncated using default
         * Java coercion, similar to how cast from double to int operates.
         * @return Integer value this node contains, if any; 0 for non-number
         *   nodes.
        public int intValue() { return 0; }
         * Returns 64-bit long value for this node, <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns 0.
         * For floating-point numbers, value is truncated using default
         * Java coercion, similar to how cast from double to long operates.
         * @return Long value this node contains, if any; 0 for non-number
         *   nodes.
        public long longValue() { return 0L; }
         * Returns 32-bit floating value for this node, <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns 0.0.
         * For integer values, conversion is done using coercion; this means
         * that an overflow is possible for `long` values
         * @return 32-bit float value this node contains, if any; 0.0 for non-number nodes.
         * @since 2.2
        public float floatValue() { return 0.0f; }
         * Returns 64-bit floating point (double) value for this node, <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns 0.0.
         * For integer values, conversion is done using coercion; this may result
         * in overflows with {@link BigInteger} values.
         * @return 64-bit double value this node contains, if any; 0.0 for non-number nodes.
         * @since 2.2
        public double doubleValue() { return 0.0; }
         * Returns floating point value for this node (as {@link BigDecimal}), <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns <code>BigDecimal.ZERO</code>.
         * @return {@link BigDecimal} value this node contains, if numeric node; <code>BigDecimal.ZERO</code> for non-number nodes.
        public BigDecimal decimalValue() { return BigDecimal.ZERO; }
         * Returns integer value for this node (as {@link BigInteger}), <b>if and only if</b>
         * this node is numeric ({@link #isNumber} returns true). For other
         * types returns <code>BigInteger.ZERO</code>.
         * @return {@link BigInteger} value this node contains, if numeric node; <code>BigInteger.ZERO</code> for non-number nodes.
        public BigInteger bigIntegerValue() { return BigInteger.ZERO; }
        /* Public API, value access with conversion(s)/coercion(s)
         * Method that will return a valid String representation of
         * the container value, if the node is a value node
         * (method {@link #isValueNode} returns true),
         * otherwise empty String.
        public abstract String asText();
         * Method similar to {@link #asText()}, except that it will return
         * <code>defaultValue</code> in cases where null value would be returned;
         * either for missing nodes (trying to access missing property, or element
         * at invalid item for array) or explicit nulls.
         * @since 2.4
        public String asText(String defaultValue) {
            String str = asText();
            return (str == null) ? defaultValue : str;
         * Method that will try to convert value of this node to a Java <b>int</b>.
         * Numbers are coerced using default Java rules; booleans convert to 0 (false)
         * and 1 (true), and Strings are parsed using default Java language integer
         * parsing rules.
         * If representation cannot be converted to an int (including structured types
         * like Objects and Arrays),
         * default value of <b>0</b> will be returned; no exceptions are thrown.
        public int asInt() {
            return asInt(0);
         * Method that will try to convert value of this node to a Java <b>int</b>.
         * Numbers are coerced using default Java rules; booleans convert to 0 (false)
         * and 1 (true), and Strings are parsed using default Java language integer
         * parsing rules.
         * If representation cannot be converted to an int (including structured types
         * like Objects and Arrays),
         * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
        public int asInt(int defaultValue) {
            return defaultValue;
         * Method that will try to convert value of this node to a Java <b>long</b>.
         * Numbers are coerced using default Java rules; booleans convert to 0 (false)
         * and 1 (true), and Strings are parsed using default Java language integer
         * parsing rules.
         * If representation cannot be converted to a long (including structured types
         * like Objects and Arrays),
         * default value of <b>0</b> will be returned; no exceptions are thrown.
        public long asLong() {
            return asLong(0L);
         * Method that will try to convert value of this node to a Java <b>long</b>.
         * Numbers are coerced using default Java rules; booleans convert to 0 (false)
         * and 1 (true), and Strings are parsed using default Java language integer
         * parsing rules.
         * If representation cannot be converted to a long (including structured types
         * like Objects and Arrays),
         * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
        public long asLong(long defaultValue) {
            return defaultValue;
         * Method that will try to convert value of this node to a Java <b>double</b>.
         * Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
         * and 1.0 (true), and Strings are parsed using default Java language integer
         * parsing rules.
         * If representation cannot be converted to an int (including structured types
         * like Objects and Arrays),
         * default value of <b>0.0</b> will be returned; no exceptions are thrown.
        public double asDouble() {
            return asDouble(0.0);
         * Method that will try to convert value of this node to a Java <b>double</b>.
         * Numbers are coerced using default Java rules; booleans convert to 0.0 (false)
         * and 1.0 (true), and Strings are parsed using default Java language integer
         * parsing rules.
         * If representation cannot be converted to an int (including structured types
         * like Objects and Arrays),
         * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
        public double asDouble(double defaultValue) {
            return defaultValue;
         * Method that will try to convert value of this node to a Java <b>boolean</b>.
         * JSON booleans map naturally; integer numbers other than 0 map to true, and
         * 0 maps to false
         * and Strings 'true' and 'false' map to corresponding values.
         * If representation cannot be converted to a boolean value (including structured types
         * like Objects and Arrays),
         * default value of <b>false</b> will be returned; no exceptions are thrown.
        public boolean asBoolean() {
            return asBoolean(false);
         * Method that will try to convert value of this node to a Java <b>boolean</b>.
         * JSON booleans map naturally; integer numbers other than 0 map to true, and
         * 0 maps to false
         * and Strings 'true' and 'false' map to corresponding values.
         * If representation cannot be converted to a boolean value (including structured types
         * like Objects and Arrays),
         * specified <b>defaultValue</b> will be returned; no exceptions are thrown.
        public boolean asBoolean(boolean defaultValue) {
            return defaultValue;
        /* Public API, extended traversal (2.10) with "required()"
         * Method that may be called to verify that {@code this} node is NOT so-called
         * "missing node": that is, one for which {@link #isMissingNode()} returns {@code true}.
         * If not missing node, {@code this} is returned to allow chaining; otherwise
         * {@link IllegalArgumentException} is thrown.
         * @return {@code this} node to allow chaining
         * @throws IllegalArgumentException if this node is "missing node"
         * @since 2.10
        public <T extends JsonNode> T require() throws IllegalArgumentException {
            return _this();
         * Method that may be called to verify that {@code this} node is neither so-called
         * "missing node" (that is, one for which {@link #isMissingNode()} returns {@code true})
         * nor "null node" (one for which {@link #isNull()} returns {@code true}).
         * If non-null non-missing node, {@code this} is returned to allow chaining; otherwise
         * {@link IllegalArgumentException} is thrown.
         * @return {@code this} node to allow chaining
         * @throws IllegalArgumentException if this node is either "missing node" or "null node"
         * @since 2.10
        public <T extends JsonNode> T requireNonNull() throws IllegalArgumentException {
            return _this();
         * Method is functionally equivalent to
         *   path(fieldName).required()
         * and can be used to check that this node is an {@code ObjectNode} (that is, represents
         * JSON Object value) and has value for specified property with key {@code fieldName}
         * (but note that value may be explicit JSON null value).
         * If this node is Object Node and has value for specified property, matching value
         * is returned; otherwise {@link IllegalArgumentException} is thrown.
         * @param propertyName Name of property to access
         * @return Value of the specified property of this Object node
         * @throws IllegalArgumentException if this node is not an Object node or if it does not
         *   have value for specified property
         * @since 2.10
        public JsonNode required(String propertyName) throws IllegalArgumentException {
            return _reportRequiredViolation("Node of type `%s` has no fields", getClass().getName());
         * Method is functionally equivalent to
         *   path(index).required()
         * and can be used to check that this node is an {@code ArrayNode} (that is, represents
         * JSON Array value) and has value for specified {@code index}
         * (but note that value may be explicit JSON null value).
         * If this node is Array Node and has value for specified index, value at index
         * is returned; otherwise {@link IllegalArgumentException} is thrown.
         * @param index Index of the value of this Array node to access
         * @return Value at specified index of this Array node
         * @throws IllegalArgumentException if this node is not an Array node or if it does not
         *   have value for specified index
         * @since 2.10
        public JsonNode required(int index) throws IllegalArgumentException {
            return _reportRequiredViolation("Node of type `%s` has no indexed values", getClass().getName());
         * Method is functionally equivalent to
         *   at(pathExpr).required()
         * and can be used to check that there is an actual value node at specified {@link JsonPointer}
         * starting from {@code this} node
         * (but note that value may be explicit JSON null value).
         * If such value node exists it is returned;
         * otherwise {@link IllegalArgumentException} is thrown.
         * @param pathExpr {@link JsonPointer} expression (as String) to use for finding value node
         * @return Matching value node for given expression
         * @throws IllegalArgumentException if no value node exists at given {@code JSON Pointer} path
         * @since 2.10
        public JsonNode requiredAt(String pathExpr) throws IllegalArgumentException {
            return requiredAt(JsonPointer.compile(pathExpr));
         * Method is functionally equivalent to
         *   at(path).required()
         * and can be used to check that there is an actual value node at specified {@link JsonPointer}
         * starting from {@code this} node
         * (but note that value may be explicit JSON null value).
         * If such value node exists it is returned;
         * otherwise {@link IllegalArgumentException} is thrown.
         * @param path {@link JsonPointer} expression to use for finding value node
         * @return Matching value node for given expression
         * @throws IllegalArgumentException if no value node exists at given {@code JSON Pointer} path
         * @since 2.10
        public final JsonNode requiredAt(final JsonPointer path) throws IllegalArgumentException {
            JsonPointer currentExpr = path;
            JsonNode curr = this;
            // Note: copied from `at()`
            while (true) {
                if (currentExpr.matches()) {
                    return curr;
                curr = curr._at(currentExpr); // lgtm [java/dereferenced-value-may-be-null]
                if (curr == null) {
                    _reportRequiredViolation("No node at '%s' (unmatched part: '%s')",
                            path, currentExpr);
                currentExpr = currentExpr.tail();
        /* Public API, value find / existence check methods
         * Method that allows checking whether this node is JSON Object node
         * and contains value for specified property. If this is the case
         * (including properties with explicit null values), returns true;
         * otherwise returns false.
         * This method is equivalent to:
         *   node.get(fieldName) != null
         * (since return value of get() is node, not value node contains)
         * NOTE: when explicit <code>null</code> values are added, this
         * method will return <code>true</code> for such properties.
         * @param fieldName Name of element to check
         * @return True if this node is a JSON Object node, and has a property
         *   entry with specified name (with any value, including null value)
        public boolean has(String fieldName) {
            return get(fieldName) != null;
         * Method that allows checking whether this node is JSON Array node
         * and contains a value for specified index
         * If this is the case
         * (including case of specified indexing having null as value), returns true;
         * otherwise returns false.
         * Note: array element indexes are 0-based.
         * This method is equivalent to:
         *   node.get(index) != null
         * NOTE: this method will return <code>true</code> for explicitly added
         * null values.
         * @param index Index to check
         * @return True if this node is a JSON Object node, and has a property
         *   entry with specified name (with any value, including null value)
        public boolean has(int index) {
            return get(index) != null;
         * Method that is similar to {@link #has(String)}, but that will
         * return <code>false</code> for explicitly added nulls.
         * This method is functionally equivalent to:
         *   node.get(fieldName) != null &amp;&amp; !node.get(fieldName).isNull()
         * @since 2.1
        public boolean hasNonNull(String fieldName) {
            JsonNode n = get(fieldName);
            return (n != null) && !n.isNull();
         * Method that is similar to {@link #has(int)}, but that will
         * return <code>false</code> for explicitly added nulls.
         * This method is equivalent to:
         *   node.get(index) != null &amp;&amp; !node.get(index).isNull()
         * @since 2.1
        public boolean hasNonNull(int index) {
            JsonNode n = get(index);
            return (n != null) && !n.isNull();
        /* Public API, container access
         * Same as calling {@link #elements}; implemented so that
         * convenience "for-each" loop can be used for looping over elements
         * of JSON Array constructs.
        public final Iterator<JsonNode> iterator() { return elements(); }
         * Method for accessing all value nodes of this Node, iff
         * this node is a JSON Array or Object node. In case of Object node,
         * field names (keys) are not included, only values.
         * For other types of nodes, returns empty iterator.
        public Iterator<JsonNode> elements() {
            return ClassUtil.emptyIterator();
         * @return Iterator that can be used to traverse all key/value pairs for
         *   object nodes; empty iterator (no contents) for other types
        public Iterator<Map.Entry<String, JsonNode>> fields() {
            return ClassUtil.emptyIterator();
        /* Public API, find methods
         * Method for finding a JSON Object field with specified name in this
         * node or its child nodes, and returning value it has.
         * If no matching field is found in this node or its descendants, returns null.
         * @param fieldName Name of field to look for
         * @return Value of first matching node found, if any; null if none
        public abstract JsonNode findValue(String fieldName);
         * Method for finding JSON Object fields with specified name, and returning
         * found ones as a List. Note that sub-tree search ends if a field is found,
         * so possible children of result nodes are <b>not</b> included.
         * If no matching fields are found in this node or its descendants, returns
         * an empty List.
         * @param fieldName Name of field to look for
        public final List<JsonNode> findValues(String fieldName)
            List<JsonNode> result = findValues(fieldName, null);
            if (result == null) {
                return Collections.emptyList();
            return result;
         * Similar to {@link #findValues}, but will additionally convert
         * values into Strings, calling {@link #asText}.
        public final List<String> findValuesAsText(String fieldName)
            List<String> result = findValuesAsText(fieldName, null);
            if (result == null) {
                return Collections.emptyList();
            return result;
         * Method similar to {@link #findValue}, but that will return a
         * "missing node" instead of null if no field is found. Missing node
         * is a specific kind of node for which {@link #isMissingNode}
         * returns true; and all value access methods return empty or
         * missing value.
         * @param fieldName Name of field to look for
         * @return Value of first matching node found; or if not found, a
         *    "missing node" (non-null instance that has no value)
        public abstract JsonNode findPath(String fieldName);
         * Method for finding a JSON Object that contains specified field,
         * within this node or its descendants.
         * If no matching field is found in this node or its descendants, returns null.
         * @param fieldName Name of field to look for
         * @return Value of first matching node found, if any; null if none
        public abstract JsonNode findParent(String fieldName);
         * Method for finding a JSON Object that contains specified field,
         * within this node or its descendants.
         * If no matching field is found in this node or its descendants, returns null.
         * @param fieldName Name of field to look for
         * @return Value of first matching node found, if any; null if none
        public final List<JsonNode> findParents(String fieldName)
            List<JsonNode> result = findParents(fieldName, null);
            if (result == null) {
                return Collections.emptyList();
            return result;
        public abstract List<JsonNode> findValues(String fieldName, List<JsonNode> foundSoFar);
        public abstract List<String> findValuesAsText(String fieldName, List<String> foundSoFar);
        public abstract List<JsonNode> findParents(String fieldName, List<JsonNode> foundSoFar);
        /* Public API, path handling
         * Short-cut equivalent to:
         *   withObject(JsonPointer.compile(expr);
         * see {@link #withObject(JsonPointer)} for full explanation.
         * @param expr {@link JsonPointer} expression to use
         * @return {@link ObjectNode} found or created
         * @since 2.14
        public final ObjectNode withObject(String expr) {
            return withObject(JsonPointer.compile(expr));
         * Short-cut equivalent to:
         *  withObject(JsonPointer.compile(expr), overwriteMode, preferIndex);
         * @since 2.14
        public final ObjectNode withObject(String expr,
                OverwriteMode overwriteMode, boolean preferIndex) {
            return withObject(JsonPointer.compile(expr), overwriteMode, preferIndex);
         * Same as {@link #withObject(JsonPointer, OverwriteMode, boolean)} but
         * with defaults of {@code OvewriteMode#NULLS} (overwrite mode)
         * and {@code true} for {@code preferIndex} (that is, will try to
         * consider {@link JsonPointer} segments index if at all possible
         * and only secondarily as property name
         * @param ptr {@link JsonPointer} that indicates path to use for Object value to return
         *   (potentially creating as necessary)
         * @return {@link ObjectNode} found or created
         * @since 2.14
        public final ObjectNode withObject(JsonPointer ptr) {
            return withObject(ptr, OverwriteMode.NULLS, true);
         * Method that can be called on Object or Array nodes, to access a Object-valued
         * node pointed to by given {@link JsonPointer}, if such a node exists:
         * or if not, an attempt is made to create one and return it.
         * For example, on document
         *  { "a" : {
         *       "b" : {
         *          "c" : 13
         *       }
         *    }
         *  }
         * calling method with {@link JsonPointer} of {@code /a/b} would return
         * {@link ObjectNode}
         *  { "c" : 13 }
         * In cases where path leads to "missing" nodes, a path is created.
         * So, for example, on above document, and
         * {@link JsonPointer} of {@code /a/x} an empty {@link ObjectNode} would
         * be returned and the document would look like:
         *  { "a" : {
         *       "b" : {
         *          "c" : 13
         *       },
         *       "x" : { }
         *    }
         *  }
         * Finally, if the path is incompatible with the document -- there is an existing
         * {@code JsonNode} through which expression cannot go -- a replacement is
         * attempted if (and only if) conversion is allowed as per {@code overwriteMode}
         * passed in. For example, with above document and expression of {@code /a/b/c},
         * conversion is allowed if passing {@code OverwriteMode.SCALARS} or
         * {@code OvewriteMode.ALL}, and resulting document would look like:
         *  { "a" : {
         *       "b" : {
         *          "c" : { }
         *       },
         *       "x" : { }
         *    }
         *  }
         * but if different modes ({@code NONE} or {@code NULLS}) is passed, an exception
         * is thrown instead.
         * @param ptr Pointer that indicates path to use for {@link ObjectNode} value to return
         *   (potentially creating one as necessary)
         * @param overwriteMode Defines which node types may be converted in case of
         *    incompatible {@code JsonPointer} expression: if conversion not allowed,
         *    {@link UnsupportedOperationException} is thrown.
         * @param preferIndex When creating a path (for empty or replacement), and path
         *    contains segment that may be an array index (simple integer number like
         *    {@code 3}), whether to construct an {@link ArrayNode} ({@code true}) or
         *    {@link ObjectNode} ({@code false}). In latter case matching property with
         *    quoted number (like {@code "3"}) is used within Object.
         * @return {@link ObjectNode} found or created
         * @throws UnsupportedOperationException if a conversion would be needed for given
         *    {@code JsonPointer}, document, but was not allowed for the type encountered
         * @since 2.14
        public ObjectNode withObject(JsonPointer ptr,
                OverwriteMode overwriteMode, boolean preferIndex) {
            // To avoid abstract method, base implementation just fails
            throw new UnsupportedOperationException("`withObject(JsonPointer)` not implemented by `"
         * Method that works in one of possible ways, depending on whether
         * {@code exprOrProperty} is a valid {@link JsonPointer} expression or
         * not (valid expression is either empty String {@code ""} or starts
         * with leading slash {@code /} character).
         * If it is, works as a short-cut to:
         *  withObject(JsonPointer.compile(exprOrProperty));
         * If it is NOT a valid {@link JsonPointer} expression, value is taken
         * as a literal Object property name and traversed like a single-segment
         * {@link JsonPointer}.
         * NOTE: before Jackson 2.14 behavior was always that of non-expression usage;
         * that is, {@code exprOrProperty} was always considered as a simple property name.
         * @deprecated Since 2.14 use {@code withObject(String)} instead
        @Deprecated // since 2.14
        public <T extends JsonNode> T with(String exprOrProperty) {
            throw new UnsupportedOperationException("`JsonNode` not of type `ObjectNode` (but "
                                    +getClass().getName()+"), cannot call `with(String)` on it");
         * Method that works in one of possible ways, depending on whether
         * {@code exprOrProperty} is a valid {@link JsonPointer} expression or
         * not (valid expression is either empty String {@code ""} or starts
         * with leading slash {@code /} character).
         * If it is, works as a short-cut to:
         *  withObject(JsonPointer.compile(exprOrProperty));
         * If it is NOT a valid {@link JsonPointer} expression, value is taken
         * as a literal Object property name and traversed like a single-segment
         * {@link JsonPointer}.
         * NOTE: before Jackson 2.14 behavior was always that of non-expression usage;
         * that is, {@code exprOrProperty} was always considered as a simple property name.
         * @param exprOrProperty Either {@link JsonPointer} expression for full access (if valid
         *   pointer expression), or the name of property for the {@link ArrayNode}.
         * @return {@link ArrayNode} found or created
        public <T extends JsonNode> T withArray(String exprOrProperty) {
            throw new UnsupportedOperationException("`JsonNode` not of type `ObjectNode` (but `"
                    +getClass().getName()+")`, cannot call `withArray()` on it");
         * Short-cut equivalent to:
         *  withArray(JsonPointer.compile(expr), overwriteMode, preferIndex);
         * @since 2.14
        public ArrayNode withArray(String expr,
                OverwriteMode overwriteMode, boolean preferIndex) {
            return withArray(JsonPointer.compile(expr), overwriteMode, preferIndex);
         * Same as {@link #withArray(JsonPointer, OverwriteMode, boolean)} but
         * with defaults of {@code OvewriteMode#NULLS} (overwrite mode)
         * and {@code true} for {@code preferIndex}.
         * @param ptr Pointer that indicates path to use for {@link ArrayNode} to return
         *   (potentially creating as necessary)
         * @return {@link ArrayNode} found or created
         * @since 2.14
        public final ArrayNode withArray(JsonPointer ptr) {
            return withArray(ptr, OverwriteMode.NULLS, true);
         * Method that can be called on Object or Array nodes, to access a Array-valued
         * node pointed to by given {@link JsonPointer}, if such a node exists:
         * or if not, an attempt is made to create one and return it.
         * For example, on document
         *  { "a" : {
         *       "b" : [ 1, 2 ]
         *    }
         *  }
         * calling method with {@link JsonPointer} of {@code /a/b} would return
         * {@code Array}
         *  [ 1, 2 ]
         * In cases where path leads to "missing" nodes, a path is created.
         * So, for example, on above document, and
         * {@link JsonPointer} of {@code /a/x} an empty {@code ArrayNode} would
         * be returned and the document would look like:
         *  { "a" : {
         *       "b" : [ 1, 2 ],
         *       "x" : [ ]
         *    }
         *  }
         * Finally, if the path is incompatible with the document -- there is an existing
         * {@code JsonNode} through which expression cannot go -- a replacement is
         * attempted if (and only if) conversion is allowed as per {@code overwriteMode}
         * passed in. For example, with above document and expression of {@code /a/b/0},
         * conversion is allowed if passing {@code OverwriteMode.SCALARS} or
         * {@code OvewriteMode.ALL}, and resulting document would look like:
         *  { "a" : {
         *       "b" : [ [ ], 2 ],
         *       "x" : [ ]
         *    }
         *  }
         * but if different modes ({@code NONE} or {@code NULLS}) is passed, an exception
         * is thrown instead.
         * @param ptr Pointer that indicates path to use for {@link ArrayNode} value to return
         *   (potentially creating it as necessary)
         * @param overwriteMode Defines which node types may be converted in case of
         *    incompatible {@code JsonPointer} expression: if conversion not allowed,
         *    an exception is thrown.
         * @param preferIndex When creating a path (for empty or replacement), and path
         *    contains segment that may be an array index (simple integer number like
         *    {@code 3}), whether to construct an {@link ArrayNode} ({@code true}) or
         *    {@link ObjectNode} ({@code false}). In latter case matching property with
         *    quoted number (like {@code "3"}) is used within Object.
         * @return {@link ArrayNode} found or created
         * @throws UnsupportedOperationException if a conversion would be needed for given
         *    {@code JsonPointer}, document, but was not allowed for the type encountered
         * @since 2.14
        public ArrayNode withArray(JsonPointer ptr,
                OverwriteMode overwriteMode, boolean preferIndex) {
            // To avoid abstract method, base implementation just fails
            throw new UnsupportedOperationException("`withArray(JsonPointer)` not implemented by "
        /* Public API, comparison
         * Entry method for invoking customizable comparison, using passed-in
         * {@link Comparator} object. Nodes will handle traversal of structured
         * types (arrays, objects), but defer to comparator for scalar value
         * comparisons. If a "natural" {@link Comparator} is passed -- one that
         * simply calls <code>equals()</code> on one of arguments, passing the other
         * -- implementation is the same as directly calling <code>equals()</code>
         * on node.
         * Default implementation simply delegates to passed in <code>comparator</code>,
         * with <code>this</code> as the first argument, and <code>other</code> as
         * the second argument.
         * @param comparator Object called to compare two scalar {@link JsonNode} 
         *   instances, and return either 0 (are equals) or non-zero (not equal)
         * @since 2.6
        public boolean equals(Comparator<JsonNode> comparator, JsonNode other) {
            return comparator.compare(this, other) == 0;
        /* Overridden standard methods
         * Method that will produce (as of Jackson 2.10) valid JSON using
         * default settings of databind, as String.
         * If you want other kinds of JSON output (or output formatted using one of
         * other Jackson-supported data formats) make sure to use
         * {@link ObjectMapper} or {@link ObjectWriter} to serialize an
         * instance, for example:
         *   String json = objectMapper.writeValueAsString(rootNode);
         * Note: method defined as abstract to ensure all implementation
         * classes explicitly implement method, instead of relying
         * on {@link Object#toString()} definition.
        public abstract String toString();
         * Alternative to {@link #toString} that will serialize this node using
         * Jackson default pretty-printer.
         * @since 2.10
        public String toPrettyString() {
            return toString();
         * Equality for node objects is defined as full (deep) value
         * equality. This means that it is possible to compare complete
         * JSON trees for equality by comparing equality of root nodes.
         * Note: marked as abstract to ensure all implementation
         * classes define it properly and not rely on definition
         * from {@link java.lang.Object}.
        public abstract boolean equals(Object o);
        /* Helper methods,  for sub-classes
        // @since 2.10
        protected <T extends JsonNode> T _this() {
            return (T) this;
         * Helper method that throws {@link IllegalArgumentException} as a result of
         * violating "required-constraint" for this node (for {@link #required} or related
         * methods).
        protected <T> T _reportRequiredViolation(String msgTemplate, Object...args) {
            throw new IllegalArgumentException(String.format(msgTemplate, args));



    Or download all of them as a single archive file:

    File name: jackson-databind-2.14.0-sources.jar
    File size: 1187952 bytes
    Release date: 2022-11-05


    Jackson Annotations Source Code

    Download and Install Jackson Binary Package

    Downloading and Reviewing jackson-*.jar

    ⇑⇑ Jackson - Java JSON library

    2022-03-29, 78328👍, 0💬